CAS 197785-18-5 appears in our catalog under these names: 3,3',4,5,5'-Pentafluoro-1,1'-biphenyl, 95%, 3,3,4,5,5-Pentafluoro-1,1-biphenyl, ≥97%, ≥97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 5g, 1g.
5-(3,5-difluorophenyl)-1,2,3-trifluorobenzene (CAS 197785-18-5) is a chemical compound with the molecular formula C12H5F5 and a molecular weight of 244.16 g/mol. IUPAC name: 5-(3,5-difluorophenyl)-1,2,3-trifluorobenzene. InChIKey: ZITJVQINFHRXTK-UHFFFAOYSA-N.
| Molecular formula | C12H5F5 |
|---|---|
| Molecular weight | 244.16 g/mol |
| IUPAC name | 5-(3,5-difluorophenyl)-1,2,3-trifluorobenzene |
| InChIKey | ZITJVQINFHRXTK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C2=CC(=C(C(=C2)F)F)F |
Computed by PubChem (NCBI)