CAS 1978292-75-9 appears in our catalog under these names: Tiotropium bromide Impurity 16, Tiotropium Bromide Impurity 5 (Iso Tiotropium Bromide Impurity) Bromide. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylacetate bromide (CAS 1978292-75-9) is a chemical compound with the molecular formula C19H22BrNO4S2 and a molecular weight of 472.4 g/mol. IUPAC name: [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylacetate bromide. InChIKey: BALCMZZLILDTJR-RHOJTKDKSA-M.
| Molecular formula | C19H22BrNO4S2 |
|---|---|
| Molecular weight | 472.4 g/mol |
| IUPAC name | [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylacetate bromide |
| InChIKey | BALCMZZLILDTJR-RHOJTKDKSA-M |
| SMILES | C[N+]1([C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)OC(=O)C(C4=CSC=C4)(C5=CC=CS5)O)C.[Br-] |
Computed by PubChem (NCBI)