CAS 197908-43-3 is the registry number for (S)-5-Methylchroman-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-5-methyl-3,4-dihydro-2H-chromen-4-ol (CAS 197908-43-3) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: (4S)-5-methyl-3,4-dihydro-2H-chromen-4-ol. InChIKey: KYCJPMMFWPHVRX-QMMMGPOBSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | (4S)-5-methyl-3,4-dihydro-2H-chromen-4-ol |
| InChIKey | KYCJPMMFWPHVRX-QMMMGPOBSA-N |
| SMILES | CC1=C2[C@H](CCOC2=CC=C1)O |
Computed by PubChem (NCBI)