CAS 1980007-52-0 is the registry number for (S)-N-(3,5-Dichlorobenzylidene)-2-methylpropane-2-sulfinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
(S)-N-[(3,5-dichlorophenyl)methylidene]-2-methylpropane-2-sulfinamide (CAS 1980007-52-0) is a chemical compound with the molecular formula C11H13Cl2NOS and a molecular weight of 278.2 g/mol. IUPAC name: (S)-N-[(3,5-dichlorophenyl)methylidene]-2-methylpropane-2-sulfinamide. InChIKey: PZEXDKSDXMGGPK-INIZCTEOSA-N.
| Molecular formula | C11H13Cl2NOS |
|---|---|
| Molecular weight | 278.2 g/mol |
| IUPAC name | (S)-N-[(3,5-dichlorophenyl)methylidene]-2-methylpropane-2-sulfinamide |
| InChIKey | PZEXDKSDXMGGPK-INIZCTEOSA-N |
| SMILES | CC(C)(C)[S@](=O)N=CC1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)