CAS 1980036-18-7 appears in our catalog under these names: EphB1–IN–1, EphB1-IN-1, 99.87%, 99.87%, EphB1-IN-1, 99.87%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 1mg, 5mg, 50 mg, 10mM/1mL, 100 mg, 5 mg.
2-chloro-N-[4-(2-chloro-5-hydroxyanilino)quinazolin-7-yl]acetamide (CAS 1980036-18-7) is a chemical compound with the molecular formula C16H12Cl2N4O2 and a molecular weight of 363.2 g/mol. IUPAC name: 2-chloro-N-[4-(2-chloro-5-hydroxyanilino)quinazolin-7-yl]acetamide. InChIKey: GVQPPCNXPVHIRJ-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2N4O2 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | 2-chloro-N-[4-(2-chloro-5-hydroxyanilino)quinazolin-7-yl]acetamide |
| InChIKey | GVQPPCNXPVHIRJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1NC(=O)CCl)N=CN=C2NC3=C(C=CC(=C3)O)Cl |
Computed by PubChem (NCBI)