Products 1980044-09-4

CAS 1980044-09-4 is the registry number for 6-(Perfluorohexyl)hexyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl acetate (CAS 1980044-09-4) is a chemical compound with the molecular formula C14H15F13O2 and a molecular weight of 462.25 g/mol. IUPAC name: 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl acetate. InChIKey: MPSXQENHAQHCJT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15F13O2
Molecular weight462.25 g/mol
IUPAC name7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl acetate
InChIKeyMPSXQENHAQHCJT-UHFFFAOYSA-N
SMILESCC(=O)OCCCCCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

Computed by PubChem (NCBI)