CAS 1980064-70-7 is the registry number for Sodium 3,4-difluorophenylacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Sodium 2-(3,4-difluorophenyl)acetate (CAS 1980064-70-7) is a chemical compound with the molecular formula C8H5F2NaO2 and a molecular weight of 194.11 g/mol. IUPAC name: sodium 2-(3,4-difluorophenyl)acetate. InChIKey: FECKBATVPCWWFR-UHFFFAOYSA-M.
| Molecular formula | C8H5F2NaO2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | sodium 2-(3,4-difluorophenyl)acetate |
| InChIKey | FECKBATVPCWWFR-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1CC(=O)[O-])F)F.[Na+] |
Computed by PubChem (NCBI)