CAS 1980085-17-3 is the registry number for 4,4-Bis(trifluoromethyl)-5,5,6,6,7,7,7-heptafluoroheptyl acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
[5,5,6,6,7,7,7-heptafluoro-4,4-bis(trifluoromethyl)heptyl] prop-2-enoate (CAS 1980085-17-3) is a chemical compound with the molecular formula C12H9F13O2 and a molecular weight of 432.18 g/mol. IUPAC name: [5,5,6,6,7,7,7-heptafluoro-4,4-bis(trifluoromethyl)heptyl] prop-2-enoate. InChIKey: GVDAUHCFCTZXEL-UHFFFAOYSA-N.
| Molecular formula | C12H9F13O2 |
|---|---|
| Molecular weight | 432.18 g/mol |
| IUPAC name | [5,5,6,6,7,7,7-heptafluoro-4,4-bis(trifluoromethyl)heptyl] prop-2-enoate |
| InChIKey | GVDAUHCFCTZXEL-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCCC(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)