CAS 1980783-92-3 is the registry number for 3-Fluoro-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-benzoic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Tert-butyl 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1980783-92-3) is a chemical compound with the molecular formula C17H24BFO4 and a molecular weight of 322.2 g/mol. IUPAC name: tert-butyl 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: ILYNBDDQSQEGKJ-UHFFFAOYSA-N.
| Molecular formula | C17H24BFO4 |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | tert-butyl 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | ILYNBDDQSQEGKJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)OC(C)(C)C)F |
Computed by PubChem (NCBI)