CAS 19811-64-4 is the registry number for Z-Gly-gly-gly-onp, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(4-nitrophenyl) 2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetate (CAS 19811-64-4) is a chemical compound with the molecular formula C20H20N4O8 and a molecular weight of 444.4 g/mol. IUPAC name: (4-nitrophenyl) 2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetate. InChIKey: FNKXEWJFZXDHIG-UHFFFAOYSA-N.
| Molecular formula | C20H20N4O8 |
|---|---|
| Molecular weight | 444.4 g/mol |
| IUPAC name | (4-nitrophenyl) 2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetate |
| InChIKey | FNKXEWJFZXDHIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC(=O)NCC(=O)NCC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)