CAS 19813-90-2 appears in our catalog under these names: 4-Phenylbenzene-1-thiol, 95%, Biphenyl–4–thiol, Biphenyl-4-thiol, 4-Phenylthiophenol 95%, BIPHENYL-4-THIOL, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg, 0,05g, 0,1g, 0,25g.
4-phenylbenzenethiol (CAS 19813-90-2) is a chemical compound with the molecular formula C12H10S and a molecular weight of 186.27 g/mol. IUPAC name: 4-phenylbenzenethiol. InChIKey: KRVHFFQFZQSNLB-UHFFFAOYSA-N.
| Molecular formula | C12H10S |
|---|---|
| Molecular weight | 186.27 g/mol |
| IUPAC name | 4-phenylbenzenethiol |
| InChIKey | KRVHFFQFZQSNLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)S |
Computed by PubChem (NCBI)