CAS 198139-51-4 appears in our catalog under these names: Oregon Green 488 Succinimidyl Ester, OG 488, SE, OG 488, SE, 2',7'-Difluoro-3',6'-dihydroxy-3-oxospiro(isobenzofuran-1(3H),9'-(9H)xanthene)-5-carboxylic acid 2,5-dioxo-1-pyrrolidinyl ester, OREGON GREEN 488 SUCCINIMIDYL ESTER, 95%, 95%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 2mg, 5 mg.
(2,5-dioxopyrrolidin-1-yl) 2',7'-difluoro-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate (CAS 198139-51-4) is a chemical compound with the molecular formula C25H13F2NO9 and a molecular weight of 509.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2',7'-difluoro-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate. InChIKey: NIPUTGPBPLFCFM-UHFFFAOYSA-N.
| Molecular formula | C25H13F2NO9 |
|---|---|
| Molecular weight | 509.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2',7'-difluoro-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate |
| InChIKey | NIPUTGPBPLFCFM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC3=C(C=C2)C4(C5=CC(=C(C=C5OC6=CC(=C(C=C64)F)O)O)F)OC3=O |
Computed by PubChem (NCBI)