CAS 198279-94-6 appears in our catalog under these names: 2-Chlorophenylhydrazine sulfate, 95%, (2-Chlorophenyl)hydrazine hemisulfate, 97%, 2–Chlorophenylhydrazine Sulfate, 2-Chlorophenylhydrazine Sulfate, >95.0%(T), 2-Chlorophenylhydrazine Sulfate, 95.0%, 95.0%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 25g, 1g, 100g, 500g.
Bis((2-chlorophenyl)hydrazine);sulfuric acid (CAS 198279-94-6) is a chemical compound with the molecular formula C12H16Cl2N4O4S and a molecular weight of 383.3 g/mol. IUPAC name: bis((2-chlorophenyl)hydrazine);sulfuric acid. InChIKey: VJPLGFWDVTWDHM-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N4O4S |
|---|---|
| Molecular weight | 383.3 g/mol |
| IUPAC name | bis((2-chlorophenyl)hydrazine);sulfuric acid |
| InChIKey | VJPLGFWDVTWDHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NN)Cl.C1=CC=C(C(=C1)NN)Cl.OS(=O)(=O)O |
Computed by PubChem (NCBI)