Products 1983186-05-5

CAS 1983186-05-5 is the registry number for Olaparib Impurity 28. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoate (CAS 1983186-05-5) is a chemical compound with the molecular formula C17H13FN2O3 and a molecular weight of 312.29 g/mol. IUPAC name: methyl 2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoate. InChIKey: VSNSDKRPMVMDDP-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13FN2O3
Molecular weight312.29 g/mol
IUPAC namemethyl 2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoate
InChIKeyVSNSDKRPMVMDDP-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CC(=C1)CC2=NNC(=O)C3=CC=CC=C32)F

Computed by PubChem (NCBI)