CAS 1983848-11-8 is the registry number for (4-Fluorobenzyl)(2-pyridinylmethyl)amine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g.
1-(4-fluorophenyl)-N-(pyridin-2-ylmethyl)methanamine;dihydrochloride (CAS 1983848-11-8) is a chemical compound with the molecular formula C13H15Cl2FN2 and a molecular weight of 289.17 g/mol. IUPAC name: 1-(4-fluorophenyl)-N-(pyridin-2-ylmethyl)methanamine;dihydrochloride. InChIKey: KMKFCBQLUQUWDT-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2FN2 |
|---|---|
| Molecular weight | 289.17 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-N-(pyridin-2-ylmethyl)methanamine;dihydrochloride |
| InChIKey | KMKFCBQLUQUWDT-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNCC2=CC=C(C=C2)F.Cl.Cl |
Computed by PubChem (NCBI)