CAS 1983957-99-8 appears in our catalog under these names: N-(4-Pyridinylmethyl)guanidine sulfate, 95%, 1-(Pyridin-4-ylmethyl)guanidine sulfate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 100g, 1g, 5g.
2-(pyridin-4-ylmethyl)guanidine;sulfuric acid (CAS 1983957-99-8) is a chemical compound with the molecular formula C7H12N4O4S and a molecular weight of 248.26 g/mol. IUPAC name: 2-(pyridin-4-ylmethyl)guanidine;sulfuric acid. InChIKey: FHUGSHMPKUTJBB-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O4S |
|---|---|
| Molecular weight | 248.26 g/mol |
| IUPAC name | 2-(pyridin-4-ylmethyl)guanidine;sulfuric acid |
| InChIKey | FHUGSHMPKUTJBB-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1CN=C(N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)