CAS 1984-04-9 is the registry number for 1-Isocyanonaphthalene . Offered by: TRC. Available pack sizes: 100mg.
1-isocyanonaphthalene (CAS 1984-04-9) is a chemical compound with the molecular formula C11H7N and a molecular weight of 153.18 g/mol. IUPAC name: 1-isocyanonaphthalene. InChIKey: PTCSLGONLAYNQB-UHFFFAOYSA-N.
| Molecular formula | C11H7N |
|---|---|
| Molecular weight | 153.18 g/mol |
| IUPAC name | 1-isocyanonaphthalene |
| InChIKey | PTCSLGONLAYNQB-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)