CAS 198470-83-6 is the registry number for N-((4-(5-Methyl-3-phenylisoxazol-4-yl)phenyl)sulfonyl)isobutyramide, sodium salt, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
CAS 198470-83-6 identifies a chemical compound with the molecular formula C20H20N2NaO4S and a molecular weight of 407.4 g/mol. InChIKey: UWIGCERGFFIHGS-UHFFFAOYSA-N.
| Molecular formula | C20H20N2NaO4S |
|---|---|
| Molecular weight | 407.4 g/mol |
| InChIKey | UWIGCERGFFIHGS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C3=CC=C(C=C3)S(=O)(=O)NC(=O)C(C)C.[Na] |
Computed by PubChem (NCBI)