CAS 198471-47-5 appears in our catalog under these names: N-((4-(5-(p-Tolyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl)phenyl)sulfonyl)acetamide, 95%, Celecoxib Impurity 56. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylacetamide (CAS 198471-47-5) is a chemical compound with the molecular formula C19H16F3N3O3S and a molecular weight of 423.4 g/mol. IUPAC name: N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylacetamide. InChIKey: AIXYDGRTMBAPLW-UHFFFAOYSA-N.
| Molecular formula | C19H16F3N3O3S |
|---|---|
| Molecular weight | 423.4 g/mol |
| IUPAC name | N-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylacetamide |
| InChIKey | AIXYDGRTMBAPLW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)NC(=O)C)C(F)(F)F |
Computed by PubChem (NCBI)