CAS 198480-55-6 appears in our catalog under these names: Pipendoxifene, >95% (HPLC), Pipendoxifene, Pipendoxifene, 98%, 98%, Pipendoxifene, 99.93%, Pipendoxifene, 99%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 100 mg, 5 mg, 10mM/1mL.
2-(4-hydroxyphenyl)-3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]indol-5-ol (CAS 198480-55-6) is a chemical compound with the molecular formula C29H32N2O3 and a molecular weight of 456.6 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]indol-5-ol. InChIKey: JICOGKJOQXTAIP-UHFFFAOYSA-N.
| Molecular formula | C29H32N2O3 |
|---|---|
| Molecular weight | 456.6 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]indol-5-ol |
| InChIKey | JICOGKJOQXTAIP-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=C1C=C(C=C2)O)CC3=CC=C(C=C3)OCCN4CCCCC4)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)