CAS 198481-33-3 appears in our catalog under these names: Bazedoxifene Acetate, Bazedoxifene Acetate, >95% (HPLC), Bazedoxifene acetate/ 98%, Bazedoxifene acetate, 1H-Indol-5-ol, 1-[[4-[2-(hexahydro-1H-azepin-1-yl)ethoxy]phenyl]methyl]-2-(4-hydroxyphenyl)-3-methyl-, acetate (1:1), ≥98%(HPLC), ≥98%(HPLC). Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, TargetMol. Available pack sizes: on request, 10mg, 25mg, 5mg, 50mg, 100mg, 200mg, 500mg.
Acetic acid;1-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol (CAS 198481-33-3) is a chemical compound with the molecular formula C32H38N2O5 and a molecular weight of 530.7 g/mol. IUPAC name: acetic acid;1-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol. InChIKey: OMZAMQFQZMUNTP-UHFFFAOYSA-N.
| Molecular formula | C32H38N2O5 |
|---|---|
| Molecular weight | 530.7 g/mol |
| IUPAC name | acetic acid;1-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-2-(4-hydroxyphenyl)-3-methylindol-5-ol |
| InChIKey | OMZAMQFQZMUNTP-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=C1C=C(C=C2)O)CC3=CC=C(C=C3)OCCN4CCCCCC4)C5=CC=C(C=C5)O.CC(=O)O |
Computed by PubChem (NCBI)