CAS 1985607-68-8 appears in our catalog under these names: Baloxavir Marboxil Impurity 24, Baloxavir Marboxil Impurity 19, Baloxavir Impurity 5. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3R)-2-[(2R)-oxolane-2-carbonyl]-11-phenylmethoxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (CAS 1985607-68-8) is a chemical compound with the molecular formula C22H23N3O6 and a molecular weight of 425.4 g/mol. IUPAC name: (3R)-2-[(2R)-oxolane-2-carbonyl]-11-phenylmethoxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione. InChIKey: TUDDCLPCPODGLQ-QZTJIDSGSA-N.
| Molecular formula | C22H23N3O6 |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | (3R)-2-[(2R)-oxolane-2-carbonyl]-11-phenylmethoxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| InChIKey | TUDDCLPCPODGLQ-QZTJIDSGSA-N |
| SMILES | C1C[C@@H](OC1)C(=O)N2[C@@H]3COCCN3C(=O)C4=C(C(=O)C=CN42)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)