CAS 198561-86-3 appears in our catalog under these names: Fmoc-l-orn(2-cl-z)-oh, 98%, Fmoc-Orn(2-Cl-Z)-OH, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
(2S)-5-[(2-chlorophenyl)methoxycarbonylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 198561-86-3) is a chemical compound with the molecular formula C28H27ClN2O6 and a molecular weight of 523.0 g/mol. IUPAC name: (2S)-5-[(2-chlorophenyl)methoxycarbonylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: CVAOOYINJZPDDP-VWLOTQADSA-N.
| Molecular formula | C28H27ClN2O6 |
|---|---|
| Molecular weight | 523.0 g/mol |
| IUPAC name | (2S)-5-[(2-chlorophenyl)methoxycarbonylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | CVAOOYINJZPDDP-VWLOTQADSA-N |
| SMILES | C1=CC=C(C(=C1)COC(=O)NCCC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)Cl |
Computed by PubChem (NCBI)