Products 1985622-33-0
CAS 1985622-33-0 appears in our catalog under these names: R110, R110, 99.90%, R110, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 100 mg, 50 mg, 10 mg, 25 mg, 5 mg, 10mM/1mL.
2-amino-N-butyl-5-(4-chlorophenyl)thiophene-3-carboxamide (CAS 1985622-33-0) is a chemical compound with the molecular formula C15H17ClN2OS and a molecular weight of 308.8 g/mol. IUPAC name: 2-amino-N-butyl-5-(4-chlorophenyl)thiophene-3-carboxamide. InChIKey: IADRJQICSPVBQR-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2OS |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | 2-amino-N-butyl-5-(4-chlorophenyl)thiophene-3-carboxamide |
| InChIKey | IADRJQICSPVBQR-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)C1=C(SC(=C1)C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)