CAS 198566-03-9 appears in our catalog under these names: 2-(5-Bromothiophen-2-yl)benzo(d)thiazole, 97%, 2-(5-Bromothiophen-2-yl)-1,3-benzothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(5-bromothiophen-2-yl)-1,3-benzothiazole (CAS 198566-03-9) is a chemical compound with the molecular formula C11H6BrNS2 and a molecular weight of 296.2 g/mol. IUPAC name: 2-(5-bromothiophen-2-yl)-1,3-benzothiazole. InChIKey: XTBLWPNBTNYBTN-UHFFFAOYSA-N.
| Molecular formula | C11H6BrNS2 |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 2-(5-bromothiophen-2-yl)-1,3-benzothiazole |
| InChIKey | XTBLWPNBTNYBTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=CC=C(S3)Br |
Computed by PubChem (NCBI)