CAS 19861-59-7 appears in our catalog under these names: 2,4,6-Trichloroisophthalonitrile, 97%, 2,4,6-Trichloroisophthalonitrile 97%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g.
2,4,6-trichlorobenzene-1,3-dicarbonitrile (CAS 19861-59-7) is a chemical compound with the molecular formula C8HCl3N2 and a molecular weight of 231.5 g/mol. IUPAC name: 2,4,6-trichlorobenzene-1,3-dicarbonitrile. InChIKey: YVSUWIHEYZXJGQ-UHFFFAOYSA-N.
| Molecular formula | C8HCl3N2 |
|---|---|
| Molecular weight | 231.5 g/mol |
| IUPAC name | 2,4,6-trichlorobenzene-1,3-dicarbonitrile |
| InChIKey | YVSUWIHEYZXJGQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)C#N)Cl)C#N)Cl |
Computed by PubChem (NCBI)