Products 198624-12-3

CAS 198624-12-3 is the registry number for 4'-Bromobiphenyl-4-yl triflate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

[4-(4-bromophenyl)phenyl] trifluoromethanesulfonate (CAS 198624-12-3) is a chemical compound with the molecular formula C13H8BrF3O3S and a molecular weight of 381.17 g/mol. IUPAC name: [4-(4-bromophenyl)phenyl] trifluoromethanesulfonate. InChIKey: LUSPTKXNKWTUFC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8BrF3O3S
Molecular weight381.17 g/mol
IUPAC name[4-(4-bromophenyl)phenyl] trifluoromethanesulfonate
InChIKeyLUSPTKXNKWTUFC-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC=C(C=C2)Br)OS(=O)(=O)C(F)(F)F

Computed by PubChem (NCBI)