Products 1986846-29-0

CAS 1986846-29-0 is the registry number for 4-tert-Butyl-2-(chloromethyl)-1,3-thiazole hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-tert-butyl-2-(chloromethyl)-1,3-thiazole;hydrochloride (CAS 1986846-29-0) is a chemical compound with the molecular formula C8H13Cl2NS and a molecular weight of 226.17 g/mol. IUPAC name: 4-tert-butyl-2-(chloromethyl)-1,3-thiazole;hydrochloride. InChIKey: FWRHYYNZOHXJNH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13Cl2NS
Molecular weight226.17 g/mol
IUPAC name4-tert-butyl-2-(chloromethyl)-1,3-thiazole;hydrochloride
InChIKeyFWRHYYNZOHXJNH-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CSC(=N1)CCl.Cl

Computed by PubChem (NCBI)