Products 1986846-38-1

CAS 1986846-38-1 is the registry number for 3-(Chloromethyl)-1-isopropylpyrrolidine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(chloromethyl)-1-propan-2-ylpyrrolidine;hydrochloride (CAS 1986846-38-1) is a chemical compound with the molecular formula C8H17Cl2N and a molecular weight of 198.13 g/mol. IUPAC name: 3-(chloromethyl)-1-propan-2-ylpyrrolidine;hydrochloride. InChIKey: OQSUOTWPPJNLFV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17Cl2N
Molecular weight198.13 g/mol
IUPAC name3-(chloromethyl)-1-propan-2-ylpyrrolidine;hydrochloride
InChIKeyOQSUOTWPPJNLFV-UHFFFAOYSA-N
SMILESCC(C)N1CCC(C1)CCl.Cl

Computed by PubChem (NCBI)