Products 1987175-47-2

CAS 1987175-47-2 is the registry number for (Boc)2-AOAc-OH*H2O. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxyacetic acid;hydrate (CAS 1987175-47-2) is a chemical compound with the molecular formula C12H23NO8 and a molecular weight of 309.31 g/mol. IUPAC name: 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxyacetic acid;hydrate. InChIKey: XNBLGIQAWTZCSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23NO8
Molecular weight309.31 g/mol
IUPAC name2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxyacetic acid;hydrate
InChIKeyXNBLGIQAWTZCSQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)OCC(=O)O.O

Computed by PubChem (NCBI)