CAS 1987175-47-2 is the registry number for (Boc)2-AOAc-OH*H2O. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g.
2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxyacetic acid;hydrate (CAS 1987175-47-2) is a chemical compound with the molecular formula C12H23NO8 and a molecular weight of 309.31 g/mol. IUPAC name: 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxyacetic acid;hydrate. InChIKey: XNBLGIQAWTZCSQ-UHFFFAOYSA-N.
| Molecular formula | C12H23NO8 |
|---|---|
| Molecular weight | 309.31 g/mol |
| IUPAC name | 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxyacetic acid;hydrate |
| InChIKey | XNBLGIQAWTZCSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)OCC(=O)O.O |
Computed by PubChem (NCBI)