CAS 1987680-60-3 is the registry number for [(1,4,5-Trimethyl-1h-imidazol-2-yl)methyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
(1,4,5-trimethylimidazol-2-yl)methanamine;dihydrochloride (CAS 1987680-60-3) is a chemical compound with the molecular formula C7H15Cl2N3 and a molecular weight of 212.12 g/mol. IUPAC name: (1,4,5-trimethylimidazol-2-yl)methanamine;dihydrochloride. InChIKey: ANKYNPCVNNJVKW-UHFFFAOYSA-N.
| Molecular formula | C7H15Cl2N3 |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | (1,4,5-trimethylimidazol-2-yl)methanamine;dihydrochloride |
| InChIKey | ANKYNPCVNNJVKW-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C(=N1)CN)C)C.Cl.Cl |
Computed by PubChem (NCBI)