CAS 19879-84-6 appears in our catalog under these names: 1-Thio-b-D-glucopyranose 2,3,4,6-Tetraacetate, >95% (HPLC), 1-thio-β-D-Glucose Tetraacetate, 1–thio–β–D–Glucose Tetraacetate, 1-Thio-beta-D-glucose tetraacetate, 97+% , 2,3,4,6-Tetra-O-acetyl-β-D-thioglucopyranose. Offered by: TRC, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 500mg, 5g, 250mg, 1000mg, 2000mg, 10000mg, 5000mg.
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-sulfanyloxan-2-yl]methyl acetate (CAS 19879-84-6) is a chemical compound with the molecular formula C14H20O9S and a molecular weight of 364.37 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-sulfanyloxan-2-yl]methyl acetate. InChIKey: SFOZKJGZNOBSHF-RGDJUOJXSA-N.
| Molecular formula | C14H20O9S |
|---|---|
| Molecular weight | 364.37 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-sulfanyloxan-2-yl]methyl acetate |
| InChIKey | SFOZKJGZNOBSHF-RGDJUOJXSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)S)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)