CAS 1988-15-4 is the registry number for 4-Amino-2,6-diisopropylphenol. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
4-amino-2,6-di(propan-2-yl)phenol (CAS 1988-15-4) is a chemical compound with the molecular formula C12H19NO and a molecular weight of 193.28 g/mol. IUPAC name: 4-amino-2,6-di(propan-2-yl)phenol. InChIKey: OIYNNJHEBQIVIJ-UHFFFAOYSA-N.
| Molecular formula | C12H19NO |
|---|---|
| Molecular weight | 193.28 g/mol |
| IUPAC name | 4-amino-2,6-di(propan-2-yl)phenol |
| InChIKey | OIYNNJHEBQIVIJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1O)C(C)C)N |
Computed by PubChem (NCBI)