CAS 19890-02-9 is the registry number for (-)-trans-Verbenol. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
(1S,2R,5S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol (CAS 19890-02-9) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: (1S,2R,5S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol. InChIKey: WONIGEXYPVIKFS-DJLDLDEBSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | (1S,2R,5S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol |
| InChIKey | WONIGEXYPVIKFS-DJLDLDEBSA-N |
| SMILES | CC1=C[C@H]([C@H]2C[C@@H]1C2(C)C)O |
Computed by PubChem (NCBI)