Products 19894-97-4
CAS 19894-97-4 appears in our catalog under these names: (-)-Myrtenol, 95%, (-)-Myrtenol, (1R)-(-)-MYRTENOL, 95%, (-)-Myrtenol, 97.90%, (-)-Myrtenol (Standard). Offered by: Combi-blocks, TargetMol, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100g, 5g, 500g, 25g, 1g, 100mg, 0,025kg, 0,05kg.
[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol (CAS 19894-97-4) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol. InChIKey: RXBQNMWIQKOSCS-IUCAKERBSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol |
| InChIKey | RXBQNMWIQKOSCS-IUCAKERBSA-N |
| SMILES | CC1([C@H]2CC=C([C@@H]1C2)CO)C |
Computed by PubChem (NCBI)