CAS 19894-99-6 is the registry number for (-)-Alpha-pinene oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 100g, 5g, 25g, 1g.
(1R,2R,4S,6R)-2,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane (CAS 19894-99-6) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: (1R,2R,4S,6R)-2,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane. InChIKey: NQFUSWIGRKFAHK-BDNRQGISSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | (1R,2R,4S,6R)-2,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane |
| InChIKey | NQFUSWIGRKFAHK-BDNRQGISSA-N |
| SMILES | C[C@@]12[C@@H]3C[C@@H](C3(C)C)C[C@@H]1O2 |
Computed by PubChem (NCBI)