CAS 1989638-24-5 is the registry number for Methyl (2R)-2-{((benzyloxy)carbonyl)amino}-3-sulfopropanoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl (2R)-3-chlorosulfonyl-2-(phenylmethoxycarbonylamino)propanoate (CAS 1989638-24-5) is a chemical compound with the molecular formula C12H14ClNO6S and a molecular weight of 335.76 g/mol. IUPAC name: methyl (2R)-3-chlorosulfonyl-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: FZZFTZQDSRBGKT-JTQLQIEISA-N.
| Molecular formula | C12H14ClNO6S |
|---|---|
| Molecular weight | 335.76 g/mol |
| IUPAC name | methyl (2R)-3-chlorosulfonyl-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | FZZFTZQDSRBGKT-JTQLQIEISA-N |
| SMILES | COC(=O)[C@H](CS(=O)(=O)Cl)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)