CAS 1989638-38-1 is the registry number for rac-(1R,3R)-3-(Morpholin-4-yl)spiro(3.3)heptan-1-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R,3R)-3-morpholin-4-ylspiro[3.3]heptan-1-amine (CAS 1989638-38-1) is a chemical compound with the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. IUPAC name: (1R,3R)-3-morpholin-4-ylspiro[3.3]heptan-1-amine. InChIKey: PAGKXEYJDCSJNN-NXEZZACHSA-N.
| Molecular formula | C11H20N2O |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | (1R,3R)-3-morpholin-4-ylspiro[3.3]heptan-1-amine |
| InChIKey | PAGKXEYJDCSJNN-NXEZZACHSA-N |
| SMILES | C1CC2(C1)[C@@H](C[C@H]2N3CCOCC3)N |
Computed by PubChem (NCBI)