Products 1989659-32-6
CAS 1989659-32-6 appears in our catalog under these names: 2-amino-4,6-dimethylpyridine-3-carboxamide hydrochloride, 95%, 2-Amino-4,6-dimethylpyridine-3-carboxamide hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-amino-4,6-dimethylpyridine-3-carboxamide;hydrochloride (CAS 1989659-32-6) is a chemical compound with the molecular formula C8H12ClN3O and a molecular weight of 201.65 g/mol. IUPAC name: 2-amino-4,6-dimethylpyridine-3-carboxamide;hydrochloride. InChIKey: NNHMVJPGNAMJJE-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN3O |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 2-amino-4,6-dimethylpyridine-3-carboxamide;hydrochloride |
| InChIKey | NNHMVJPGNAMJJE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(=O)N)N)C.Cl |
Computed by PubChem (NCBI)