Products 1989659-65-5
CAS 1989659-65-5 is the registry number for 7-Bromo-1-methyl-2-(trifluoromethyl)-1H-imidazo(4,5-c)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-bromo-1-methyl-2-(trifluoromethyl)imidazo[4,5-c]pyridine (CAS 1989659-65-5) is a chemical compound with the molecular formula C8H5BrF3N3 and a molecular weight of 280.04 g/mol. IUPAC name: 7-bromo-1-methyl-2-(trifluoromethyl)imidazo[4,5-c]pyridine. InChIKey: AGBHYKWVDNCYPS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3N3 |
|---|---|
| Molecular weight | 280.04 g/mol |
| IUPAC name | 7-bromo-1-methyl-2-(trifluoromethyl)imidazo[4,5-c]pyridine |
| InChIKey | AGBHYKWVDNCYPS-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=NC=C2N=C1C(F)(F)F)Br |
Computed by PubChem (NCBI)