Products 1989659-93-9

CAS 1989659-93-9 is the registry number for Methyl 3-methyl-5-sulfamoylfuran-2-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 3-methyl-5-sulfamoylfuran-2-carboxylate (CAS 1989659-93-9) is a chemical compound with the molecular formula C7H9NO5S and a molecular weight of 219.22 g/mol. IUPAC name: methyl 3-methyl-5-sulfamoylfuran-2-carboxylate. InChIKey: XUBBCSXLRVEWMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO5S
Molecular weight219.22 g/mol
IUPAC namemethyl 3-methyl-5-sulfamoylfuran-2-carboxylate
InChIKeyXUBBCSXLRVEWMQ-UHFFFAOYSA-N
SMILESCC1=C(OC(=C1)S(=O)(=O)N)C(=O)OC

Computed by PubChem (NCBI)