CAS 1989672-33-4 is the registry number for tert-Butyl N-{1-(4-(4-chlorophenyl)piperazine-1-carbonyl)cyclopropyl}carbamate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Tert-butyl N-[1-[4-(4-chlorophenyl)piperazine-1-carbonyl]cyclopropyl]carbamate (CAS 1989672-33-4) is a chemical compound with the molecular formula C19H26ClN3O3 and a molecular weight of 379.9 g/mol. IUPAC name: tert-butyl N-[1-[4-(4-chlorophenyl)piperazine-1-carbonyl]cyclopropyl]carbamate. InChIKey: SVMYGYMTPNBKCF-UHFFFAOYSA-N.
| Molecular formula | C19H26ClN3O3 |
|---|---|
| Molecular weight | 379.9 g/mol |
| IUPAC name | tert-butyl N-[1-[4-(4-chlorophenyl)piperazine-1-carbonyl]cyclopropyl]carbamate |
| InChIKey | SVMYGYMTPNBKCF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CC1)C(=O)N2CCN(CC2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)