CAS 198969-28-7 is the registry number for (2R,4S)-1-tert-Butyl 2-methyl 4-(benzoyloxy)pyrrolidine-1,2-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-O-tert-butyl 2-O-methyl (2R,4S)-4-benzoyloxypyrrolidine-1,2-dicarboxylate (CAS 198969-28-7) is a chemical compound with the molecular formula C18H23NO6 and a molecular weight of 349.4 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4S)-4-benzoyloxypyrrolidine-1,2-dicarboxylate. InChIKey: HCMBKFLKTBCNNU-UONOGXRCSA-N.
| Molecular formula | C18H23NO6 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-benzoyloxypyrrolidine-1,2-dicarboxylate |
| InChIKey | HCMBKFLKTBCNNU-UONOGXRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)OC)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)