CAS 19900-69-7 appears in our catalog under these names: 4,4'-Methylenebis(2,6-diisopropylaniline), 97%, 4,4'-Methylenebis(2,6-diisopropylaniline), 4,4'-Methylenebis(2,6-diisopropylaniline), 98%, 98%, 4,4'-Methylenebis(2,6-diisopropylaniline), 98%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 10mg, 50mg, 250mg.
4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)aniline (CAS 19900-69-7) is a chemical compound with the molecular formula C25H38N2 and a molecular weight of 366.6 g/mol. IUPAC name: 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)aniline. InChIKey: KZTROCYBPMKGAW-UHFFFAOYSA-N.
| Molecular formula | C25H38N2 |
|---|---|
| Molecular weight | 366.6 g/mol |
| IUPAC name | 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)aniline |
| InChIKey | KZTROCYBPMKGAW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1N)C(C)C)CC2=CC(=C(C(=C2)C(C)C)N)C(C)C |
Computed by PubChem (NCBI)