Products 199165-61-2
CAS 199165-61-2 is the registry number for cyclopropyl-N-(2-methyl-5-(isopropyl)phenyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2-methyl-5-propan-2-ylphenyl)cyclopropanecarboxamide (CAS 199165-61-2) is a chemical compound with the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. IUPAC name: N-(2-methyl-5-propan-2-ylphenyl)cyclopropanecarboxamide. InChIKey: XVMVFEXIZICLQU-UHFFFAOYSA-N.
| Molecular formula | C14H19NO |
|---|---|
| Molecular weight | 217.31 g/mol |
| IUPAC name | N-(2-methyl-5-propan-2-ylphenyl)cyclopropanecarboxamide |
| InChIKey | XVMVFEXIZICLQU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)C)NC(=O)C2CC2 |
Computed by PubChem (NCBI)