CAS 1992-91-2 is the registry number for 4,4,5,5,6,6,6-Heptafluorohexane-1,2-diol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4,4,5,5,6,6,6-heptafluorohexane-1,2-diol (CAS 1992-91-2) is a chemical compound with the molecular formula C6H7F7O2 and a molecular weight of 244.11 g/mol. IUPAC name: 4,4,5,5,6,6,6-heptafluorohexane-1,2-diol. InChIKey: GGHXTGYWFGCELG-UHFFFAOYSA-N.
| Molecular formula | C6H7F7O2 |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | 4,4,5,5,6,6,6-heptafluorohexane-1,2-diol |
| InChIKey | GGHXTGYWFGCELG-UHFFFAOYSA-N |
| SMILES | C(C(CO)O)C(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)