Products 1992052-49-9
CAS 1992052-49-9 appears in our catalog under these names: SI-2 hydrochloride/ 98.18% (existing batch purity), SI–2 hydrochloride, 1-Methyl-2-(2-(1-(pyridin-2-yl)ethylidene)hydrazineyl)-1H-benzo[d]imidazole hydrochloride, 98%, 98%, SI-2 (hydrochloride), 98.06%, SI-2 (hydrochloride) (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 50 mg, 10 mg.
1-methyl-N-[(E)-1-pyridin-2-ylethylideneamino]benzimidazol-2-amine;hydrochloride (CAS 1992052-49-9) is a chemical compound with the molecular formula C15H16ClN5 and a molecular weight of 301.77 g/mol. IUPAC name: 1-methyl-N-[(E)-1-pyridin-2-ylethylideneamino]benzimidazol-2-amine;hydrochloride. InChIKey: CDYJHORKRVKALB-NWBUNABESA-N.
| Molecular formula | C15H16ClN5 |
|---|---|
| Molecular weight | 301.77 g/mol |
| IUPAC name | 1-methyl-N-[(E)-1-pyridin-2-ylethylideneamino]benzimidazol-2-amine;hydrochloride |
| InChIKey | CDYJHORKRVKALB-NWBUNABESA-N |
| SMILES | C/C(=N\NC1=NC2=CC=CC=C2N1C)/C3=CC=CC=N3.Cl |
Computed by PubChem (NCBI)