CAS 1992782-05-4 is the registry number for Potassium (2-chloropyridin-4-yl)trifluoroborate, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Potassium (2-chloro-4-pyridinyl)-trifluoroboranuide (CAS 1992782-05-4) is a chemical compound with the molecular formula C5H3BClF3KN and a molecular weight of 219.44 g/mol. IUPAC name: potassium (2-chloro-4-pyridinyl)-trifluoroboranuide. InChIKey: USJDEMNUMMCTRN-UHFFFAOYSA-N.
| Molecular formula | C5H3BClF3KN |
|---|---|
| Molecular weight | 219.44 g/mol |
| IUPAC name | potassium (2-chloro-4-pyridinyl)-trifluoroboranuide |
| InChIKey | USJDEMNUMMCTRN-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC(=NC=C1)Cl)(F)(F)F.[K+] |
Computed by PubChem (NCBI)