Products 1993194-85-6

CAS 1993194-85-6 is the registry number for 5-(1H-1,2,4-Triazol-1-ylmethyl)-2-furoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid;hydrochloride (CAS 1993194-85-6) is a chemical compound with the molecular formula C8H8ClN3O3 and a molecular weight of 229.62 g/mol. IUPAC name: 5-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid;hydrochloride. InChIKey: XXCAXUSQZNFOPV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClN3O3
Molecular weight229.62 g/mol
IUPAC name5-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid;hydrochloride
InChIKeyXXCAXUSQZNFOPV-UHFFFAOYSA-N
SMILESC1=C(OC(=C1)C(=O)O)CN2C=NC=N2.Cl

Computed by PubChem (NCBI)