CAS 1993194-85-6 is the registry number for 5-(1H-1,2,4-Triazol-1-ylmethyl)-2-furoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid;hydrochloride (CAS 1993194-85-6) is a chemical compound with the molecular formula C8H8ClN3O3 and a molecular weight of 229.62 g/mol. IUPAC name: 5-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid;hydrochloride. InChIKey: XXCAXUSQZNFOPV-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O3 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | 5-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid;hydrochloride |
| InChIKey | XXCAXUSQZNFOPV-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C(=O)O)CN2C=NC=N2.Cl |
Computed by PubChem (NCBI)