CAS 19932-27-5 appears in our catalog under these names: 3-(1H,1H,5H-Octafluoropentyloxy)-1,2-epoxypropane, 95%, Glycidyl 2,2,3,3,4,4,5,5–octafluoropentyl ether, GLYCIDYL 2,2,3,3,4,4,5,5-OCTAFLUOROPENT&, 3-(1H,1h,5h-octafluoropentyloxy)-1,2-epoxypropane, 98%, 98%, 3-(1H,1H,5H-Octafluoropentyloxy)-1,2-propenoxide. Offered by: Combi-blocks, GLPBio, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 5ml.
2-(2,2,3,3,4,4,5,5-octafluoropentoxymethyl)oxirane (CAS 19932-27-5) is a chemical compound with the molecular formula C8H8F8O2 and a molecular weight of 288.13 g/mol. IUPAC name: 2-(2,2,3,3,4,4,5,5-octafluoropentoxymethyl)oxirane. InChIKey: NABHRPSATHTFNS-UHFFFAOYSA-N.
| Molecular formula | C8H8F8O2 |
|---|---|
| Molecular weight | 288.13 g/mol |
| IUPAC name | 2-(2,2,3,3,4,4,5,5-octafluoropentoxymethyl)oxirane |
| InChIKey | NABHRPSATHTFNS-UHFFFAOYSA-N |
| SMILES | C1C(O1)COCC(C(C(C(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)